C27H56 — CID 143367876
3,3-dimethyloctan-2-ylcyclopentane;6-ethyl-3-methylnonane (PubChem CID 143367876) has the molecular formula C27H56 and a molecular weight of 380.75 g/mol. Its IUPAC name is 3,3-dimethyloctan-2-ylcyclopentane;6-ethyl-3-methylnonane.
| Compound Name | 3,3-dimethyloctan-2-ylcyclopentane;6-ethyl-3-methylnonane |
|---|---|
| PubChem CID | 143367876 |
| Molecular Formula | C27H56 |
| Molecular Weight | 380.75 g/mol |
| Exact Mass | 380.44 |
| IUPAC Name | 3,3-dimethyloctan-2-ylcyclopentane;6-ethyl-3-methylnonane |
| SMILES | CCCC(CC)CCC(C)CC.CCCCCC(C)(C)C(C)C1CCCC1 |
| InChI | InChI=1S/C15H30.C12H26/c1-5-6-9-12-15(3,4)13(2)14-10-7-8-11-14;1-5-8-12(7-3)10-9-11(4)6-2/h13-14H,5-12H2,1-4H3;11-12H,5-10H2,1-4H3 |
| InChIKey | BTBZQURQBZPYRN-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.75 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|