C24H26N4S — CID 143370408
N-(1H-indazol-5-yl)-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-amine (PubChem CID 143370408) has the molecular formula C24H26N4S and a molecular weight of 402.57 g/mol. Its IUPAC name is N-(1H-indazol-5-yl)-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(1H-indazol-5-yl)-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 143370408 |
| Molecular Formula | C24H26N4S |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | N-(1H-indazol-5-yl)-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3csc(Nc4ccc5[nH]ncc5c4)n3)ccc21 |
| InChI | InChI=1S/C24H26N4S/c1-23(2)9-10-24(3,4)19-12-15(5-7-18(19)23)21-14-29-22(27-21)26-17-6-8-20-16(11-17)13-25-28-20/h5-8,11-14H,9-10H2,1-4H3,(H,25,28)(H,26,27) |
| InChIKey | RDIDXWYBOCHESG-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |