C27H42N4O4 — CID 143371247
N-[3-[4-(1-formylpiperidin-4-yl)quinazolin-7-yl]oxypropyl]-N-methylbutanamide;2-methoxy-2-methylpropane (PubChem CID 143371247) has the molecular formula C27H42N4O4 and a molecular weight of 486.66 g/mol. Its IUPAC name is N-[3-[4-(1-formylpiperidin-4-yl)quinazolin-7-yl]oxypropyl]-N-methylbutanamide;2-methoxy-2-methylpropane.
| Compound Name | N-[3-[4-(1-formylpiperidin-4-yl)quinazolin-7-yl]oxypropyl]-N-methylbutanamide;2-methoxy-2-methylpropane |
|---|---|
| PubChem CID | 143371247 |
| Molecular Formula | C27H42N4O4 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | N-[3-[4-(1-formylpiperidin-4-yl)quinazolin-7-yl]oxypropyl]-N-methylbutanamide;2-methoxy-2-methylpropane |
| SMILES | CCCC(=O)N(C)CCCOc1ccc2c(C3CCN(C=O)CC3)ncnc2c1.COC(C)(C)C |
| InChI | InChI=1S/C22H30N4O3.C5H12O/c1-3-5-21(28)25(2)10-4-13-29-18-6-7-19-20(14-18)23-15-24-22(19)17-8-11-26(16-27)12-9-17;1-5(2,3)6-4/h6-7,14-17H,3-5,8-13H2,1-2H3;1-4H3 |
| InChIKey | JETNZDJSRYQGRP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|