C18H30 — CID 143379887
ethane;(3E,4Z)-3-ethylidene-1-methyl-2-prop-2-enyl-4-prop-2-enylidenecyclopentene (PubChem CID 143379887) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is ethane;(3E,4Z)-3-ethylidene-1-methyl-2-prop-2-enyl-4-prop-2-enylidenecyclopentene.
| Compound Name | ethane;(3E,4Z)-3-ethylidene-1-methyl-2-prop-2-enyl-4-prop-2-enylidenecyclopentene |
|---|---|
| PubChem CID | 143379887 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | ethane;(3E,4Z)-3-ethylidene-1-methyl-2-prop-2-enyl-4-prop-2-enylidenecyclopentene |
| SMILES | C=C/C=C1/CC(C)=C(CC=C)/C1=C/C.CC.CC |
| InChI | InChI=1S/C14H18.2C2H6/c1-5-8-12-10-11(4)14(9-6-2)13(12)7-3;2*1-2/h5-8H,1-2,9-10H2,3-4H3;2*1-2H3/b12-8-,13-7+;; |
| InChIKey | NPEHEUOVOVKKOK-CIYZABQGSA-N |
| XLogP | 6.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|