C19H24 — CID 143742296
acetylene;(3E)-1,4-dimethyl-3-prop-2-enylidene-2H-naphthalene;ethane (PubChem CID 143742296) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is acetylene;(3E)-1,4-dimethyl-3-prop-2-enylidene-2H-naphthalene;ethane.
| Compound Name | acetylene;(3E)-1,4-dimethyl-3-prop-2-enylidene-2H-naphthalene;ethane |
|---|---|
| PubChem CID | 143742296 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | acetylene;(3E)-1,4-dimethyl-3-prop-2-enylidene-2H-naphthalene;ethane |
| SMILES | C#C.C=C/C=C1\CC(C)=c2ccccc2=C1C.CC |
| InChI | InChI=1S/C15H16.C2H6.C2H2/c1-4-7-13-10-11(2)14-8-5-6-9-15(14)12(13)3;2*1-2/h4-9H,1,10H2,2-3H3;1-2H3;1-2H/b13-7+;; |
| InChIKey | KVBLMXWJQJKFOY-JOZOFPPJSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|