C9H14N2OS — CID 143391707
7,7-dimethyl-5,6,8,8a-tetrahydro-3aH-[1,3]thiazolo[5,4-c]azepin-4-one (PubChem CID 143391707) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 7,7-dimethyl-5,6,8,8a-tetrahydro-3aH-[1,3]thiazolo[5,4-c]azepin-4-one.
| Compound Name | 7,7-dimethyl-5,6,8,8a-tetrahydro-3aH-[1,3]thiazolo[5,4-c]azepin-4-one |
|---|---|
| PubChem CID | 143391707 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 7,7-dimethyl-5,6,8,8a-tetrahydro-3aH-[1,3]thiazolo[5,4-c]azepin-4-one |
| SMILES | CC1(C)CNC(=O)C2SC=NC2C1 |
| InChI | InChI=1S/C9H14N2OS/c1-9(2)3-6-7(13-5-11-6)8(12)10-4-9/h5-7H,3-4H2,1-2H3,(H,10,12) |
| InChIKey | YCYOVWAUDIUQMF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |