C28H56N8O4 — CID 10897072
6,6,13,13,20,20,27,27-octamethyl-1,4,8,11,15,18,22,25-octazacyclooctacosane-2,3,16,17-tetrone (PubChem CID 10897072) has the molecular formula C28H56N8O4 and a molecular weight of 568.81 g/mol. Its IUPAC name is 6,6,13,13,20,20,27,27-octamethyl-1,4,8,11,15,18,22,25-octazacyclooctacosane-2,3,16,17-tetrone.
| Compound Name | 6,6,13,13,20,20,27,27-octamethyl-1,4,8,11,15,18,22,25-octazacyclooctacosane-2,3,16,17-tetrone |
|---|---|
| PubChem CID | 10897072 |
| Molecular Formula | C28H56N8O4 |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.44 |
| IUPAC Name | 6,6,13,13,20,20,27,27-octamethyl-1,4,8,11,15,18,22,25-octazacyclooctacosane-2,3,16,17-tetrone |
| SMILES | CC1(C)CNCCNCC(C)(C)CNC(=O)C(=O)NCC(C)(C)CNCCNCC(C)(C)CNC(=O)C(=O)NC1 |
| InChI | InChI=1S/C28H56N8O4/c1-25(2)13-29-9-10-30-14-26(3,4)19-35-23(39)24(40)36-20-28(7,8)16-32-12-11-31-15-27(5,6)18-34-22(38)21(37)33-17-25/h29-32H,9-20H2,1-8H3,(H,33,37)(H,34,38)(H,35,39)(H,36,40) |
| InChIKey | RMXWUOJXRBTREL-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 164.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|