About thiophene-2-carbonyl 4-propan-2-ylpiperazine-1-carboxylate
thiophene-2-carbonyl 4-propan-2-ylpiperazine-1-carboxylate (PubChem CID 143396047) has the molecular formula C13H18N2O3S
and a molecular weight of 282.36 g/mol. Its IUPAC name is thiophene-2-carbonyl 4-propan-2-ylpiperazine-1-carboxylate.
Molecular Properties
| Compound Name | thiophene-2-carbonyl 4-propan-2-ylpiperazine-1-carboxylate |
| PubChem CID | 143396047 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | thiophene-2-carbonyl 4-propan-2-ylpiperazine-1-carboxylate |
| SMILES | CC(C)N1CCN(C(=O)OC(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C13H18N2O3S/c1-10(2)14-5-7-15(8-6-14)13(17)18-12(16)11-4-3-9-19-11/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | SJCNQBGBPXTSBL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze thiophene-2-carbonyl 4-propan-2-ylpiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophene-2-carbonyl 4-propan-2-ylpiperazine-1-carboxylate?
The IUPAC name of thiophene-2-carbonyl 4-propan-2-ylpiperazine-1-carboxylate (CID 143396047) is thiophene-2-carbonyl 4-propan-2-ylpiperazine-1-carboxylate.
What is the SMILES notation for thiophene-2-carbonyl 4-propan-2-ylpiperazine-1-carboxylate?
The canonical SMILES for thiophene-2-carbonyl 4-propan-2-ylpiperazine-1-carboxylate is CC(C)N1CCN(C(=O)OC(=O)c2cccs2)CC1.
What is the InChIKey of thiophene-2-carbonyl 4-propan-2-ylpiperazine-1-carboxylate?
The InChIKey is SJCNQBGBPXTSBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O3S/c1-10(2)14-5-7-15(8-6-14)13(17)18-12(16)11-4-3-9-19-11/h3-4,9-10H,5-8H2,1-2H3.
What are the key properties of thiophene-2-carbonyl 4-propan-2-ylpiperazine-1-carboxylate?
thiophene-2-carbonyl 4-propan-2-ylpiperazine-1-carboxylate has a molecular weight of 282.36 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene-2-carbonyl 4-propan-2-ylpiperazine-1-carboxylate is sourced from PubChem (CID 143396047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).