C19H32N6 — CID 143397435
N-methyl-N'-[5-methyl-2-[(4-methylpiperazin-1-yl)methyl]-1,3-diazecin-4-yl]propane-1,3-diamine (PubChem CID 143397435) has the molecular formula C19H32N6 and a molecular weight of 344.51 g/mol. Its IUPAC name is N-methyl-N'-[5-methyl-2-[(4-methylpiperazin-1-yl)methyl]-1,3-diazecin-4-yl]propane-1,3-diamine.
| Compound Name | N-methyl-N'-[5-methyl-2-[(4-methylpiperazin-1-yl)methyl]-1,3-diazecin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 143397435 |
| Molecular Formula | C19H32N6 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | N-methyl-N'-[5-methyl-2-[(4-methylpiperazin-1-yl)methyl]-1,3-diazecin-4-yl]propane-1,3-diamine |
| SMILES | CNCCCNc1nc(CN2CCN(C)CC2)ncccccc1C |
| InChI | InChI=1S/C19H32N6/c1-17-8-5-4-6-10-21-18(16-25-14-12-24(3)13-15-25)23-19(17)22-11-7-9-20-2/h4-6,8,10,20H,7,9,11-16H2,1-3H3,(H,21,22,23) |
| InChIKey | BKINAMFOYMPYIJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|