C19H33N3S — CID 143400937
ethane;1-[(E)-(2-ethyl-4-methylpentylidene)amino]-3-(3-methylcyclohepta-1,4,6-trien-1-yl)thiourea (PubChem CID 143400937) has the molecular formula C19H33N3S and a molecular weight of 335.56 g/mol. Its IUPAC name is ethane;1-[(E)-(2-ethyl-4-methylpentylidene)amino]-3-(3-methylcyclohepta-1,4,6-trien-1-yl)thiourea.
| Compound Name | ethane;1-[(E)-(2-ethyl-4-methylpentylidene)amino]-3-(3-methylcyclohepta-1,4,6-trien-1-yl)thiourea |
|---|---|
| PubChem CID | 143400937 |
| Molecular Formula | C19H33N3S |
| Molecular Weight | 335.56 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | ethane;1-[(E)-(2-ethyl-4-methylpentylidene)amino]-3-(3-methylcyclohepta-1,4,6-trien-1-yl)thiourea |
| SMILES | CC.CCC(/C=N/NC(=S)NC1=CC(C)C=CC=C1)CC(C)C |
| InChI | InChI=1S/C17H27N3S.C2H6/c1-5-15(10-13(2)3)12-18-20-17(21)19-16-9-7-6-8-14(4)11-16;1-2/h6-9,11-15H,5,10H2,1-4H3,(H2,19,20,21);1-2H3/b18-12+; |
| InChIKey | PPGWENVEURJMCX-XMMWENQYSA-N |
| XLogP | 5.18 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|