C12H15F2N — CID 143407746
4-(4,7-difluorocyclohepta-1,3,6-trien-1-yl)piperidine (PubChem CID 143407746) has the molecular formula C12H15F2N and a molecular weight of 211.25 g/mol. Its IUPAC name is 4-(4,7-difluorocyclohepta-1,3,6-trien-1-yl)piperidine.
| Compound Name | 4-(4,7-difluorocyclohepta-1,3,6-trien-1-yl)piperidine |
|---|---|
| PubChem CID | 143407746 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 4-(4,7-difluorocyclohepta-1,3,6-trien-1-yl)piperidine |
| SMILES | FC1=CC=C(C2CCNCC2)C(F)=CC1 |
| InChI | InChI=1S/C12H15F2N/c13-10-1-3-11(12(14)4-2-10)9-5-7-15-8-6-9/h1,3-4,9,15H,2,5-8H2 |
| InChIKey | LCIHYYAUTAEMSO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |