C19H32FNO — CID 143413380
ethane;3-fluoroprop-1-ene;1-[(3-methylcyclohepta-2,4,6-trien-1-yl)methyl]piperidin-4-ol (PubChem CID 143413380) has the molecular formula C19H32FNO and a molecular weight of 309.47 g/mol. Its IUPAC name is ethane;3-fluoroprop-1-ene;1-[(3-methylcyclohepta-2,4,6-trien-1-yl)methyl]piperidin-4-ol.
| Compound Name | ethane;3-fluoroprop-1-ene;1-[(3-methylcyclohepta-2,4,6-trien-1-yl)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 143413380 |
| Molecular Formula | C19H32FNO |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | ethane;3-fluoroprop-1-ene;1-[(3-methylcyclohepta-2,4,6-trien-1-yl)methyl]piperidin-4-ol |
| SMILES | C=CCF.CC.CC1=CC(CN2CCC(O)CC2)C=CC=C1 |
| InChI | InChI=1S/C14H21NO.C3H5F.C2H6/c1-12-4-2-3-5-13(10-12)11-15-8-6-14(16)7-9-15;1-2-3-4;1-2/h2-5,10,13-14,16H,6-9,11H2,1H3;2H,1,3H2;1-2H3 |
| InChIKey | QEADRLVSEQIFLM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|