About cyclopropanamine;1-methoxyundecane-1,10-diol
cyclopropanamine;1-methoxyundecane-1,10-diol (PubChem CID 143414663) has the molecular formula C15H33NO3
and a molecular weight of 275.43 g/mol. Its IUPAC name is cyclopropanamine;1-methoxyundecane-1,10-diol.
Molecular Properties
| Compound Name | cyclopropanamine;1-methoxyundecane-1,10-diol |
| PubChem CID | 143414663 |
| Molecular Formula | C15H33NO3 |
| Molecular Weight | 275.43 g/mol |
| Exact Mass | 275.25 |
| IUPAC Name | cyclopropanamine;1-methoxyundecane-1,10-diol |
| SMILES | COC(O)CCCCCCCCC(C)O.NC1CC1 |
| InChI | InChI=1S/C12H26O3.C3H7N/c1-11(13)9-7-5-3-4-6-8-10-12(14)15-2;4-3-1-2-3/h11-14H,3-10H2,1-2H3;3H,1-2,4H2 |
| InChIKey | BPTYQIYOWXJHAO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclopropanamine;1-methoxyundecane-1,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropanamine;1-methoxyundecane-1,10-diol?
The IUPAC name of cyclopropanamine;1-methoxyundecane-1,10-diol (CID 143414663) is cyclopropanamine;1-methoxyundecane-1,10-diol.
What is the SMILES notation for cyclopropanamine;1-methoxyundecane-1,10-diol?
The canonical SMILES for cyclopropanamine;1-methoxyundecane-1,10-diol is COC(O)CCCCCCCCC(C)O.NC1CC1.
What is the InChIKey of cyclopropanamine;1-methoxyundecane-1,10-diol?
The InChIKey is BPTYQIYOWXJHAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O3.C3H7N/c1-11(13)9-7-5-3-4-6-8-10-12(14)15-2;4-3-1-2-3/h11-14H,3-10H2,1-2H3;3H,1-2,4H2.
What are the key properties of cyclopropanamine;1-methoxyundecane-1,10-diol?
cyclopropanamine;1-methoxyundecane-1,10-diol has a molecular weight of 275.43 g/mol, XLogP of 2.56, 10 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropanamine;1-methoxyundecane-1,10-diol is sourced from PubChem (CID 143414663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).