C20H21NO2S2 — CID 143415320
4-[2-(1-benzothiophen-3-ylsulfanyl)phenyl]butyl-methylcarbamic acid (PubChem CID 143415320) has the molecular formula C20H21NO2S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 4-[2-(1-benzothiophen-3-ylsulfanyl)phenyl]butyl-methylcarbamic acid.
| Compound Name | 4-[2-(1-benzothiophen-3-ylsulfanyl)phenyl]butyl-methylcarbamic acid |
|---|---|
| PubChem CID | 143415320 |
| Molecular Formula | C20H21NO2S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 4-[2-(1-benzothiophen-3-ylsulfanyl)phenyl]butyl-methylcarbamic acid |
| SMILES | CN(CCCCc1ccccc1Sc1csc2ccccc12)C(=O)O |
| InChI | InChI=1S/C20H21NO2S2/c1-21(20(22)23)13-7-6-9-15-8-2-4-11-17(15)25-19-14-24-18-12-5-3-10-16(18)19/h2-5,8,10-12,14H,6-7,9,13H2,1H3,(H,22,23) |
| InChIKey | WTRCZPNFZDEWAU-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|