C11H11NS3 — CID 86082755
1-benzothiophen-3-yl N,N-dimethylcarbamodithioate (PubChem CID 86082755) has the molecular formula C11H11NS3 and a molecular weight of 253.42 g/mol. Its IUPAC name is 1-benzothiophen-3-yl N,N-dimethylcarbamodithioate.
| Compound Name | 1-benzothiophen-3-yl N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 86082755 |
| Molecular Formula | C11H11NS3 |
| Molecular Weight | 253.42 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 1-benzothiophen-3-yl N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)Sc1csc2ccccc12 |
| InChI | InChI=1S/C11H11NS3/c1-12(2)11(13)15-10-7-14-9-6-4-3-5-8(9)10/h3-7H,1-2H3 |
| InChIKey | KDGNXHZFAQEGPT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|