C15H17NO2S2 — CID 126551607
(1,4-dihydroxynaphthalen-2-yl) N,N-diethylcarbamodithioate (PubChem CID 126551607) has the molecular formula C15H17NO2S2 and a molecular weight of 307.44 g/mol. Its IUPAC name is (1,4-dihydroxynaphthalen-2-yl) N,N-diethylcarbamodithioate.
| Compound Name | (1,4-dihydroxynaphthalen-2-yl) N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 126551607 |
| Molecular Formula | C15H17NO2S2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | (1,4-dihydroxynaphthalen-2-yl) N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)Sc1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C15H17NO2S2/c1-3-16(4-2)15(19)20-13-9-12(17)10-7-5-6-8-11(10)14(13)18/h5-9,17-18H,3-4H2,1-2H3 |
| InChIKey | PSGCOTGWPVPHKM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|