C20H37N3 — CID 143415663
ethane;N'-ethyl-N-[[4-[(methylideneamino)methyl]phenyl]methyl]-N'-propylbutane-1,4-diamine (PubChem CID 143415663) has the molecular formula C20H37N3 and a molecular weight of 319.54 g/mol. Its IUPAC name is ethane;N'-ethyl-N-[[4-[(methylideneamino)methyl]phenyl]methyl]-N'-propylbutane-1,4-diamine.
| Compound Name | ethane;N'-ethyl-N-[[4-[(methylideneamino)methyl]phenyl]methyl]-N'-propylbutane-1,4-diamine |
|---|---|
| PubChem CID | 143415663 |
| Molecular Formula | C20H37N3 |
| Molecular Weight | 319.54 g/mol |
| Exact Mass | 319.30 |
| IUPAC Name | ethane;N'-ethyl-N-[[4-[(methylideneamino)methyl]phenyl]methyl]-N'-propylbutane-1,4-diamine |
| SMILES | C=NCc1ccc(CNCCCCN(CC)CCC)cc1.CC |
| InChI | InChI=1S/C18H31N3.C2H6/c1-4-13-21(5-2)14-7-6-12-20-16-18-10-8-17(9-11-18)15-19-3;1-2/h8-11,20H,3-7,12-16H2,1-2H3;1-2H3 |
| InChIKey | IRYIIZIQBSAUEK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|