C26H41N3O — CID 143415741
N'-hexyl-N'-[4-[[(5-methylfuran-2-yl)methylideneamino]methyl]phenyl]-N-propylbutane-1,4-diamine (PubChem CID 143415741) has the molecular formula C26H41N3O and a molecular weight of 411.63 g/mol. Its IUPAC name is N'-hexyl-N'-[4-[[(5-methylfuran-2-yl)methylideneamino]methyl]phenyl]-N-propylbutane-1,4-diamine.
| Compound Name | N'-hexyl-N'-[4-[[(5-methylfuran-2-yl)methylideneamino]methyl]phenyl]-N-propylbutane-1,4-diamine |
|---|---|
| PubChem CID | 143415741 |
| Molecular Formula | C26H41N3O |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.32 |
| IUPAC Name | N'-hexyl-N'-[4-[[(5-methylfuran-2-yl)methylideneamino]methyl]phenyl]-N-propylbutane-1,4-diamine |
| SMILES | CCCCCCN(CCCCNCCC)c1ccc(C/N=C/c2ccc(C)o2)cc1 |
| InChI | InChI=1S/C26H41N3O/c1-4-6-7-9-19-29(20-10-8-18-27-17-5-2)25-14-12-24(13-15-25)21-28-22-26-16-11-23(3)30-26/h11-16,22,27H,4-10,17-21H2,1-3H3/b28-22+ |
| InChIKey | ZUOGGLAOWZHFHV-XAYXJRQQSA-N |
| XLogP | 6.37 |
| TPSA | 40.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|