C16H16F2N4 — CID 143417377
1,4-difluorobenzene;(12R)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine (PubChem CID 143417377) has the molecular formula C16H16F2N4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 1,4-difluorobenzene;(12R)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine.
| Compound Name | 1,4-difluorobenzene;(12R)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine |
|---|---|
| PubChem CID | 143417377 |
| Molecular Formula | C16H16F2N4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1,4-difluorobenzene;(12R)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine |
| SMILES | Fc1ccc(F)cc1.N[C@@H]1CCc2nc3cnccc3n2C1 |
| InChI | InChI=1S/C10H12N4.C6H4F2/c11-7-1-2-10-13-8-5-12-4-3-9(8)14(10)6-7;7-5-1-2-6(8)4-3-5/h3-5,7H,1-2,6,11H2;1-4H/t7-;/m1./s1 |
| InChIKey | YCJTUQBLJFZQPH-OGFXRTJISA-N |
| XLogP | 2.67 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |