C17H14F6N4 — CID 143417363
1,2,4-trifluorobenzene;(12R)-4-(trifluoromethyl)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-12-amine (PubChem CID 143417363) has the molecular formula C17H14F6N4 and a molecular weight of 388.32 g/mol. Its IUPAC name is 1,2,4-trifluorobenzene;(12R)-4-(trifluoromethyl)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-12-amine.
| Compound Name | 1,2,4-trifluorobenzene;(12R)-4-(trifluoromethyl)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-12-amine |
|---|---|
| PubChem CID | 143417363 |
| Molecular Formula | C17H14F6N4 |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 1,2,4-trifluorobenzene;(12R)-4-(trifluoromethyl)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-12-amine |
| SMILES | Fc1ccc(F)c(F)c1.N[C@@H]1CCc2nc3cnc(C(F)(F)F)cc3n2C1 |
| InChI | InChI=1S/C11H11F3N4.C6H3F3/c12-11(13,14)9-3-8-7(4-16-9)17-10-2-1-6(15)5-18(8)10;7-4-1-2-5(8)6(9)3-4/h3-4,6H,1-2,5,15H2;1-3H/t6-;/m1./s1 |
| InChIKey | YHZJKXFIJRVNAX-FYZOBXCZSA-N |
| XLogP | 3.83 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|