C16H14ClF3N4 — CID 143234886
(12R)-3-chloro-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine;1,2,4-trifluorobenzene (PubChem CID 143234886) has the molecular formula C16H14ClF3N4 and a molecular weight of 354.76 g/mol. Its IUPAC name is (12R)-3-chloro-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine;1,2,4-trifluorobenzene.
| Compound Name | (12R)-3-chloro-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine;1,2,4-trifluorobenzene |
|---|---|
| PubChem CID | 143234886 |
| Molecular Formula | C16H14ClF3N4 |
| Molecular Weight | 354.76 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | (12R)-3-chloro-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine;1,2,4-trifluorobenzene |
| SMILES | Fc1ccc(F)c(F)c1.N[C@@H]1CCc2nc3ccnc(Cl)c3n2C1 |
| InChI | InChI=1S/C10H11ClN4.C6H3F3/c11-10-9-7(3-4-13-10)14-8-2-1-6(12)5-15(8)9;7-4-1-2-5(8)6(9)3-4/h3-4,6H,1-2,5,12H2;1-3H/t6-;/m1./s1 |
| InChIKey | GNIGASJMOSZUIH-FYZOBXCZSA-N |
| XLogP | 3.46 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.76 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|