C16H15F3N4 — CID 143417376
1,4-difluorobenzene;(12R)-4-fluoro-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-12-amine (PubChem CID 143417376) has the molecular formula C16H15F3N4 and a molecular weight of 320.32 g/mol. Its IUPAC name is 1,4-difluorobenzene;(12R)-4-fluoro-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-12-amine.
| Compound Name | 1,4-difluorobenzene;(12R)-4-fluoro-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-12-amine |
|---|---|
| PubChem CID | 143417376 |
| Molecular Formula | C16H15F3N4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 1,4-difluorobenzene;(12R)-4-fluoro-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-12-amine |
| SMILES | Fc1ccc(F)cc1.N[C@@H]1CCc2nc3cnc(F)cc3n2C1 |
| InChI | InChI=1S/C10H11FN4.C6H4F2/c11-9-3-8-7(4-13-9)14-10-2-1-6(12)5-15(8)10;7-5-1-2-6(8)4-3-5/h3-4,6H,1-2,5,12H2;1-4H/t6-;/m1./s1 |
| InChIKey | LNKCLBINJADLJF-FYZOBXCZSA-N |
| XLogP | 2.81 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|