C7H12O5 — CID 143417401
1-[(2S,3S,4R,6R)-3,4,6-trihydroxyoxan-2-yl]ethanone (PubChem CID 143417401) has the molecular formula C7H12O5 and a molecular weight of 176.17 g/mol. Its IUPAC name is 1-[(2S,3S,4R,6R)-3,4,6-trihydroxyoxan-2-yl]ethanone.
| Compound Name | 1-[(2S,3S,4R,6R)-3,4,6-trihydroxyoxan-2-yl]ethanone |
|---|---|
| PubChem CID | 143417401 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 1-[(2S,3S,4R,6R)-3,4,6-trihydroxyoxan-2-yl]ethanone |
| SMILES | CC(=O)[C@H]1O[C@@H](O)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H12O5/c1-3(8)7-6(11)4(9)2-5(10)12-7/h4-7,9-11H,2H2,1H3/t4-,5-,6+,7-/m1/s1 |
| InChIKey | NDFKOCJPZHFMQV-MVIOUDGNSA-N |
| XLogP | -1.60 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |