C20H35FN2 — CID 143418719
N'-(4,4-dimethylpent-1-en-3-yl)-3-(3-fluorophenyl)propanimidamide;ethane (PubChem CID 143418719) has the molecular formula C20H35FN2 and a molecular weight of 322.51 g/mol. Its IUPAC name is N'-(4,4-dimethylpent-1-en-3-yl)-3-(3-fluorophenyl)propanimidamide;ethane.
| Compound Name | N'-(4,4-dimethylpent-1-en-3-yl)-3-(3-fluorophenyl)propanimidamide;ethane |
|---|---|
| PubChem CID | 143418719 |
| Molecular Formula | C20H35FN2 |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.28 |
| IUPAC Name | N'-(4,4-dimethylpent-1-en-3-yl)-3-(3-fluorophenyl)propanimidamide;ethane |
| SMILES | C=CC(/N=C(\N)CCc1cccc(F)c1)C(C)(C)C.CC.CC |
| InChI | InChI=1S/C16H23FN2.2C2H6/c1-5-14(16(2,3)4)19-15(18)10-9-12-7-6-8-13(17)11-12;2*1-2/h5-8,11,14H,1,9-10H2,2-4H3,(H2,18,19);2*1-2H3 |
| InChIKey | QZSNAOZWLKBDTC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|