C12H17FN2 — CID 63175789
N'-[2-(3-fluorophenyl)ethyl]butanimidamide (PubChem CID 63175789) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is N'-[2-(3-fluorophenyl)ethyl]butanimidamide.
| Compound Name | N'-[2-(3-fluorophenyl)ethyl]butanimidamide |
|---|---|
| PubChem CID | 63175789 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | N'-[2-(3-fluorophenyl)ethyl]butanimidamide |
| SMILES | CCC/C(N)=N\CCc1cccc(F)c1 |
| InChI | InChI=1S/C12H17FN2/c1-2-4-12(14)15-8-7-10-5-3-6-11(13)9-10/h3,5-6,9H,2,4,7-8H2,1H3,(H2,14,15) |
| InChIKey | GWDBHIVQXWMOSC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|