C13H16ClNO3S — CID 143419901
methyl 3-[[(5-chlorothiophene-2-carbonyl)amino]methyl]cyclopentane-1-carboxylate (PubChem CID 143419901) has the molecular formula C13H16ClNO3S and a molecular weight of 301.80 g/mol. Its IUPAC name is methyl 3-[[(5-chlorothiophene-2-carbonyl)amino]methyl]cyclopentane-1-carboxylate.
| Compound Name | methyl 3-[[(5-chlorothiophene-2-carbonyl)amino]methyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 143419901 |
| Molecular Formula | C13H16ClNO3S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | methyl 3-[[(5-chlorothiophene-2-carbonyl)amino]methyl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCC(CNC(=O)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C13H16ClNO3S/c1-18-13(17)9-3-2-8(6-9)7-15-12(16)10-4-5-11(14)19-10/h4-5,8-9H,2-3,6-7H2,1H3,(H,15,16) |
| InChIKey | IRCSLRUMIBEVJH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |