C23H23N3O4 — CID 143421446
4-(2,3-dihydro-1H-inden-5-ylamino)-2-[(3S)-2-hydroxy-3-methyl-6-oxopiperidin-3-yl]isoindole-1,3-dione (PubChem CID 143421446) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-5-ylamino)-2-[(3S)-2-hydroxy-3-methyl-6-oxopiperidin-3-yl]isoindole-1,3-dione.
| Compound Name | 4-(2,3-dihydro-1H-inden-5-ylamino)-2-[(3S)-2-hydroxy-3-methyl-6-oxopiperidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 143421446 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-5-ylamino)-2-[(3S)-2-hydroxy-3-methyl-6-oxopiperidin-3-yl]isoindole-1,3-dione |
| SMILES | C[C@]1(N2C(=O)c3cccc(Nc4ccc5c(c4)CCC5)c3C2=O)CCC(=O)NC1O |
| InChI | InChI=1S/C23H23N3O4/c1-23(11-10-18(27)25-22(23)30)26-20(28)16-6-3-7-17(19(16)21(26)29)24-15-9-8-13-4-2-5-14(13)12-15/h3,6-9,12,22,24,30H,2,4-5,10-11H2,1H3,(H,25,27)/t22?,23-/m0/s1 |
| InChIKey | RDWARQMBGGLDLI-WCSIJFPASA-N |
| XLogP | 2.50 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|