C16H22N2O3S — CID 143422122
tert-butyl N-[2-(1-hydroxybutyl)thieno[2,3-c]pyridin-3-yl]carbamate (PubChem CID 143422122) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is tert-butyl N-[2-(1-hydroxybutyl)thieno[2,3-c]pyridin-3-yl]carbamate.
| Compound Name | tert-butyl N-[2-(1-hydroxybutyl)thieno[2,3-c]pyridin-3-yl]carbamate |
|---|---|
| PubChem CID | 143422122 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | tert-butyl N-[2-(1-hydroxybutyl)thieno[2,3-c]pyridin-3-yl]carbamate |
| SMILES | CCCC(O)c1sc2cnccc2c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22N2O3S/c1-5-6-11(19)14-13(18-15(20)21-16(2,3)4)10-7-8-17-9-12(10)22-14/h7-9,11,19H,5-6H2,1-4H3,(H,18,20) |
| InChIKey | TYEAJKDLTUSLDA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |