C23H40N6O4 — CID 143428543
ethyl 2-[1-[3-[[6-amino-2-butoxy-5-(methylideneamino)pyrimidin-4-yl]-(methoxymethyl)amino]propyl]piperidin-3-yl]acetate (PubChem CID 143428543) has the molecular formula C23H40N6O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is ethyl 2-[1-[3-[[6-amino-2-butoxy-5-(methylideneamino)pyrimidin-4-yl]-(methoxymethyl)amino]propyl]piperidin-3-yl]acetate.
| Compound Name | ethyl 2-[1-[3-[[6-amino-2-butoxy-5-(methylideneamino)pyrimidin-4-yl]-(methoxymethyl)amino]propyl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 143428543 |
| Molecular Formula | C23H40N6O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | ethyl 2-[1-[3-[[6-amino-2-butoxy-5-(methylideneamino)pyrimidin-4-yl]-(methoxymethyl)amino]propyl]piperidin-3-yl]acetate |
| SMILES | C=Nc1c(N)nc(OCCCC)nc1N(CCCN1CCCC(CC(=O)OCC)C1)COC |
| InChI | InChI=1S/C23H40N6O4/c1-5-7-14-33-23-26-21(24)20(25-3)22(27-23)29(17-31-4)13-9-12-28-11-8-10-18(16-28)15-19(30)32-6-2/h18H,3,5-17H2,1-2,4H3,(H2,24,26,27) |
| InChIKey | WGQCWWLFDFNSSH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|