C18H17N5O — CID 143429074
3-N-[4-(4-amino-3-ethenylphenoxy)pyrimidin-2-yl]benzene-1,3-diamine (PubChem CID 143429074) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is 3-N-[4-(4-amino-3-ethenylphenoxy)pyrimidin-2-yl]benzene-1,3-diamine.
| Compound Name | 3-N-[4-(4-amino-3-ethenylphenoxy)pyrimidin-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 143429074 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3-N-[4-(4-amino-3-ethenylphenoxy)pyrimidin-2-yl]benzene-1,3-diamine |
| SMILES | C=Cc1cc(Oc2ccnc(Nc3cccc(N)c3)n2)ccc1N |
| InChI | InChI=1S/C18H17N5O/c1-2-12-10-15(6-7-16(12)20)24-17-8-9-21-18(23-17)22-14-5-3-4-13(19)11-14/h2-11H,1,19-20H2,(H,21,22,23) |
| InChIKey | LKKOGTUGFUQIHN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|