C35H37N3O3 — CID 143433533
ethyl (2E)-2-[[4-(1,3-benzoxazol-2-yl)-N-methylanilino]methylidene]-3-[benzyl(cyclohept-4-en-1-yl)amino]but-3-enoate (PubChem CID 143433533) has the molecular formula C35H37N3O3 and a molecular weight of 547.70 g/mol. Its IUPAC name is ethyl (2E)-2-[[4-(1,3-benzoxazol-2-yl)-N-methylanilino]methylidene]-3-[benzyl(cyclohept-4-en-1-yl)amino]but-3-enoate.
| Compound Name | ethyl (2E)-2-[[4-(1,3-benzoxazol-2-yl)-N-methylanilino]methylidene]-3-[benzyl(cyclohept-4-en-1-yl)amino]but-3-enoate |
|---|---|
| PubChem CID | 143433533 |
| Molecular Formula | C35H37N3O3 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | ethyl (2E)-2-[[4-(1,3-benzoxazol-2-yl)-N-methylanilino]methylidene]-3-[benzyl(cyclohept-4-en-1-yl)amino]but-3-enoate |
| SMILES | C=C(/C(=C\N(C)c1ccc(-c2nc3ccccc3o2)cc1)C(=O)OCC)N(Cc1ccccc1)C1CCC=CCC1 |
| InChI | InChI=1S/C35H37N3O3/c1-4-40-35(39)31(26(2)38(24-27-14-8-7-9-15-27)30-16-10-5-6-11-17-30)25-37(3)29-22-20-28(21-23-29)34-36-32-18-12-13-19-33(32)41-34/h5-9,12-15,18-23,25,30H,2,4,10-11,16-17,24H2,1,3H3/b31-25+ |
| InChIKey | PSEDVUCSPLMGTE-QCKNELIISA-N |
| XLogP | 7.89 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|