C17H20ClN5S — CID 143434692
1-[2-(3-chlorophenyl)tetrazol-5-yl]-N-(4H-thiopyran-2-ylmethyl)butan-1-amine (PubChem CID 143434692) has the molecular formula C17H20ClN5S and a molecular weight of 361.90 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)tetrazol-5-yl]-N-(4H-thiopyran-2-ylmethyl)butan-1-amine.
| Compound Name | 1-[2-(3-chlorophenyl)tetrazol-5-yl]-N-(4H-thiopyran-2-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 143434692 |
| Molecular Formula | C17H20ClN5S |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-[2-(3-chlorophenyl)tetrazol-5-yl]-N-(4H-thiopyran-2-ylmethyl)butan-1-amine |
| SMILES | CCCC(NCC1=CCC=CS1)c1nnn(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C17H20ClN5S/c1-2-6-16(19-12-15-9-3-4-10-24-15)17-20-22-23(21-17)14-8-5-7-13(18)11-14/h4-5,7-11,16,19H,2-3,6,12H2,1H3 |
| InChIKey | VYBMLWZIUMRKRV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |