C27H29ClN4O4S — CID 143436903
5-chloro-N-[[3-[3-[[hydroxy(phenyl)methyl]amino]-4-piperidin-1-ylphenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide (PubChem CID 143436903) has the molecular formula C27H29ClN4O4S and a molecular weight of 541.07 g/mol. Its IUPAC name is 5-chloro-N-[[3-[3-[[hydroxy(phenyl)methyl]amino]-4-piperidin-1-ylphenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[[3-[3-[[hydroxy(phenyl)methyl]amino]-4-piperidin-1-ylphenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 143436903 |
| Molecular Formula | C27H29ClN4O4S |
| Molecular Weight | 541.07 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 5-chloro-N-[[3-[3-[[hydroxy(phenyl)methyl]amino]-4-piperidin-1-ylphenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCC1CN(c2ccc(N3CCCCC3)c(NC(O)c3ccccc3)c2)C(=O)O1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C27H29ClN4O4S/c28-24-12-11-23(37-24)26(34)29-16-20-17-32(27(35)36-20)19-9-10-22(31-13-5-2-6-14-31)21(15-19)30-25(33)18-7-3-1-4-8-18/h1,3-4,7-12,15,20,25,30,33H,2,5-6,13-14,16-17H2,(H,29,34) |
| InChIKey | QRLBYFYMFUSCAP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.07 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|