C24H32ClN5O4S — CID 163566160
N-[[3-[4-(3-aminopyrrolidin-1-yl)-3-(1-hydroxypentylamino)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-5-chlorothiophene-2-carboxamide (PubChem CID 163566160) has the molecular formula C24H32ClN5O4S and a molecular weight of 522.07 g/mol. Its IUPAC name is N-[[3-[4-(3-aminopyrrolidin-1-yl)-3-(1-hydroxypentylamino)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[[3-[4-(3-aminopyrrolidin-1-yl)-3-(1-hydroxypentylamino)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 163566160 |
| Molecular Formula | C24H32ClN5O4S |
| Molecular Weight | 522.07 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | N-[[3-[4-(3-aminopyrrolidin-1-yl)-3-(1-hydroxypentylamino)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-5-chlorothiophene-2-carboxamide |
| SMILES | CCCCC(O)Nc1cc(N2CC(CNC(=O)c3ccc(Cl)s3)OC2=O)ccc1N1CCC(N)C1 |
| InChI | InChI=1S/C24H32ClN5O4S/c1-2-3-4-22(31)28-18-11-16(5-6-19(18)29-10-9-15(26)13-29)30-14-17(34-24(30)33)12-27-23(32)20-7-8-21(25)35-20/h5-8,11,15,17,22,28,31H,2-4,9-10,12-14,26H2,1H3,(H,27,32) |
| InChIKey | FVJGKMCKGMICNK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.07 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|