C22H28N2OS — CID 143447005
(3Z)-2-methyl-3-[(2Z)-penta-2,4-dienylidene]-N,4-dipropyl-1,5-benzothiazepine-7-carboxamide (PubChem CID 143447005) has the molecular formula C22H28N2OS and a molecular weight of 368.55 g/mol. Its IUPAC name is (3Z)-2-methyl-3-[(2Z)-penta-2,4-dienylidene]-N,4-dipropyl-1,5-benzothiazepine-7-carboxamide.
| Compound Name | (3Z)-2-methyl-3-[(2Z)-penta-2,4-dienylidene]-N,4-dipropyl-1,5-benzothiazepine-7-carboxamide |
|---|---|
| PubChem CID | 143447005 |
| Molecular Formula | C22H28N2OS |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (3Z)-2-methyl-3-[(2Z)-penta-2,4-dienylidene]-N,4-dipropyl-1,5-benzothiazepine-7-carboxamide |
| SMILES | C=C/C=C\C=C1\C(CCC)=Nc2cc(C(=O)NCCC)ccc2SC1C |
| InChI | InChI=1S/C22H28N2OS/c1-5-8-9-11-18-16(4)26-21-13-12-17(22(25)23-14-7-3)15-20(21)24-19(18)10-6-2/h5,8-9,11-13,15-16H,1,6-7,10,14H2,2-4H3,(H,23,25)/b9-8-,18-11+ |
| InChIKey | DXLJLVQSAGZMOA-YKWGYASXSA-N |
| XLogP | 5.86 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|