C21H26N2O2S — CID 169197405
(2E,3Z)-4-ethyl-3-ethylidene-N-(3-methoxypropyl)-2-prop-2-enylidene-1,5-benzothiazepine-7-carboxamide (PubChem CID 169197405) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is (2E,3Z)-4-ethyl-3-ethylidene-N-(3-methoxypropyl)-2-prop-2-enylidene-1,5-benzothiazepine-7-carboxamide.
| Compound Name | (2E,3Z)-4-ethyl-3-ethylidene-N-(3-methoxypropyl)-2-prop-2-enylidene-1,5-benzothiazepine-7-carboxamide |
|---|---|
| PubChem CID | 169197405 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (2E,3Z)-4-ethyl-3-ethylidene-N-(3-methoxypropyl)-2-prop-2-enylidene-1,5-benzothiazepine-7-carboxamide |
| SMILES | C=C/C=C1/Sc2ccc(C(=O)NCCCOC)cc2N=C(CC)/C1=C/C |
| InChI | InChI=1S/C21H26N2O2S/c1-5-9-19-16(6-2)17(7-3)23-18-14-15(10-11-20(18)26-19)21(24)22-12-8-13-25-4/h5-6,9-11,14H,1,7-8,12-13H2,2-4H3,(H,22,24)/b16-6-,19-9+ |
| InChIKey | FMUNRDNBEHBHBV-MFYAAWBHSA-N |
| XLogP | 5.06 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|