C10H21N3 — CID 143447824
1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,2-dimethylhydrazine;methanamine (PubChem CID 143447824) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,2-dimethylhydrazine;methanamine.
| Compound Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,2-dimethylhydrazine;methanamine |
|---|---|
| PubChem CID | 143447824 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,2-dimethylhydrazine;methanamine |
| SMILES | C=C/C=C(\C=C/C)N(C)NC.CN |
| InChI | InChI=1S/C9H16N2.CH5N/c1-5-7-9(8-6-2)11(4)10-3;1-2/h5-8,10H,1H2,2-4H3;2H2,1H3/b8-6-,9-7+; |
| InChIKey | ZNJMLTLJSSRYAJ-JYWQNNPFSA-N |
| XLogP | 1.27 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|