C20H32N2O3 — CID 143450004
ethane;8-(3-hydroxyphenyl)-7,8-dimethyl-2,3,6,7,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione (PubChem CID 143450004) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is ethane;8-(3-hydroxyphenyl)-7,8-dimethyl-2,3,6,7,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione.
| Compound Name | ethane;8-(3-hydroxyphenyl)-7,8-dimethyl-2,3,6,7,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 143450004 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | ethane;8-(3-hydroxyphenyl)-7,8-dimethyl-2,3,6,7,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
| SMILES | CC.CC.CC1CN2C(=O)CNC(=O)C2CC1(C)c1cccc(O)c1 |
| InChI | InChI=1S/C16H20N2O3.2C2H6/c1-10-9-18-13(15(21)17-8-14(18)20)7-16(10,2)11-4-3-5-12(19)6-11;2*1-2/h3-6,10,13,19H,7-9H2,1-2H3,(H,17,21);2*1-2H3 |
| InChIKey | AAVXJZQPWPVDAY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |