C12H9F2NO2S — CID 143451926
2-cyclopropyl-5-(2,4-difluorophenyl)-4-hydroperoxy-1,3-thiazole (PubChem CID 143451926) has the molecular formula C12H9F2NO2S and a molecular weight of 269.27 g/mol. Its IUPAC name is 2-cyclopropyl-5-(2,4-difluorophenyl)-4-hydroperoxy-1,3-thiazole.
| Compound Name | 2-cyclopropyl-5-(2,4-difluorophenyl)-4-hydroperoxy-1,3-thiazole |
|---|---|
| PubChem CID | 143451926 |
| Molecular Formula | C12H9F2NO2S |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 2-cyclopropyl-5-(2,4-difluorophenyl)-4-hydroperoxy-1,3-thiazole |
| SMILES | OOc1nc(C2CC2)sc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C12H9F2NO2S/c13-7-3-4-8(9(14)5-7)10-11(17-16)15-12(18-10)6-1-2-6/h3-6,16H,1-2H2 |
| InChIKey | FZNHTDFHSPJZBB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|