C12H9F2NOS — CID 143452203
2-cyclopropyl-5-(2,4-difluorophenyl)-1,3-thiazol-4-ol (PubChem CID 143452203) has the molecular formula C12H9F2NOS and a molecular weight of 253.27 g/mol. Its IUPAC name is 2-cyclopropyl-5-(2,4-difluorophenyl)-1,3-thiazol-4-ol.
| Compound Name | 2-cyclopropyl-5-(2,4-difluorophenyl)-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 143452203 |
| Molecular Formula | C12H9F2NOS |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 2-cyclopropyl-5-(2,4-difluorophenyl)-1,3-thiazol-4-ol |
| SMILES | Oc1nc(C2CC2)sc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C12H9F2NOS/c13-7-3-4-8(9(14)5-7)10-11(16)15-12(17-10)6-1-2-6/h3-6,16H,1-2H2 |
| InChIKey | RAUJYROZVCVJIV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |