C12H15F3N2O2 — CID 143453509
2-(methylamino)acetamide;2-[3-(trifluoromethyl)phenyl]acetaldehyde (PubChem CID 143453509) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 2-(methylamino)acetamide;2-[3-(trifluoromethyl)phenyl]acetaldehyde.
| Compound Name | 2-(methylamino)acetamide;2-[3-(trifluoromethyl)phenyl]acetaldehyde |
|---|---|
| PubChem CID | 143453509 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-(methylamino)acetamide;2-[3-(trifluoromethyl)phenyl]acetaldehyde |
| SMILES | CNCC(N)=O.O=CCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F3O.C3H8N2O/c10-9(11,12)8-3-1-2-7(6-8)4-5-13;1-5-2-3(4)6/h1-3,5-6H,4H2;5H,2H2,1H3,(H2,4,6) |
| InChIKey | ZGWVPBRBBCJAJR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|