C10H15NO2 — CID 143458434
(4,5-dimethoxycyclohepta-1,3,5-trien-1-yl)methanamine (PubChem CID 143458434) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (4,5-dimethoxycyclohepta-1,3,5-trien-1-yl)methanamine.
| Compound Name | (4,5-dimethoxycyclohepta-1,3,5-trien-1-yl)methanamine |
|---|---|
| PubChem CID | 143458434 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (4,5-dimethoxycyclohepta-1,3,5-trien-1-yl)methanamine |
| SMILES | COC1=CC=C(CN)CC=C1OC |
| InChI | InChI=1S/C10H15NO2/c1-12-9-5-3-8(7-11)4-6-10(9)13-2/h3,5-6H,4,7,11H2,1-2H3 |
| InChIKey | AONQAMSALCUAQJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |