C17H20N8 — CID 143461050
3-[(E)-1-[methyl-(methylideneamino)amino]prop-1-en-2-yl]-N-(2-prop-1-en-2-ylpyrazol-3-yl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 143461050) has the molecular formula C17H20N8 and a molecular weight of 336.40 g/mol. Its IUPAC name is 3-[(E)-1-[methyl-(methylideneamino)amino]prop-1-en-2-yl]-N-(2-prop-1-en-2-ylpyrazol-3-yl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 3-[(E)-1-[methyl-(methylideneamino)amino]prop-1-en-2-yl]-N-(2-prop-1-en-2-ylpyrazol-3-yl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 143461050 |
| Molecular Formula | C17H20N8 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3-[(E)-1-[methyl-(methylideneamino)amino]prop-1-en-2-yl]-N-(2-prop-1-en-2-ylpyrazol-3-yl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | C=NN(C)/C=C(\C)c1cnc2c(Nc3ccnn3C(=C)C)nccn12 |
| InChI | InChI=1S/C17H20N8/c1-12(2)25-15(6-7-21-25)22-16-17-20-10-14(24(17)9-8-19-16)13(3)11-23(5)18-4/h6-11H,1,4H2,2-3,5H3,(H,19,22)/b13-11+ |
| InChIKey | DUPSBIAQNQZSDC-ACCUITESSA-N |
| XLogP | 3.07 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|