C26H29N7 — CID 143756340
3-N-[3-[(Z)-1-(3-aminophenyl)-1-ethyliminobut-2-en-2-yl]imidazo[1,2-a]pyrazin-8-yl]-1-N-ethylbenzene-1,3-diamine (PubChem CID 143756340) has the molecular formula C26H29N7 and a molecular weight of 439.57 g/mol. Its IUPAC name is 3-N-[3-[(Z)-1-(3-aminophenyl)-1-ethyliminobut-2-en-2-yl]imidazo[1,2-a]pyrazin-8-yl]-1-N-ethylbenzene-1,3-diamine.
| Compound Name | 3-N-[3-[(Z)-1-(3-aminophenyl)-1-ethyliminobut-2-en-2-yl]imidazo[1,2-a]pyrazin-8-yl]-1-N-ethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 143756340 |
| Molecular Formula | C26H29N7 |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 3-N-[3-[(Z)-1-(3-aminophenyl)-1-ethyliminobut-2-en-2-yl]imidazo[1,2-a]pyrazin-8-yl]-1-N-ethylbenzene-1,3-diamine |
| SMILES | C/C=C(C(=N\CC)\c1cccc(N)c1)/c1cnc2c(Nc3cccc(NCC)c3)nccn12 |
| InChI | InChI=1S/C26H29N7/c1-4-22(24(29-6-3)18-9-7-10-19(27)15-18)23-17-31-26-25(30-13-14-33(23)26)32-21-12-8-11-20(16-21)28-5-2/h4,7-17,28H,5-6,27H2,1-3H3,(H,30,32)/b22-4-,29-24+ |
| InChIKey | XTTZZWCMBZIIHG-FDHANXGQSA-N |
| XLogP | 5.40 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|