C25H29N5 — CID 143464869
3-N-[3-[(2E,4E,7Z)-4-ethenyl-5-methylnona-2,4,7-trien-2-yl]imidazo[1,2-a]pyrazin-8-yl]-1-N-methylbenzene-1,3-diamine (PubChem CID 143464869) has the molecular formula C25H29N5 and a molecular weight of 399.54 g/mol. Its IUPAC name is 3-N-[3-[(2E,4E,7Z)-4-ethenyl-5-methylnona-2,4,7-trien-2-yl]imidazo[1,2-a]pyrazin-8-yl]-1-N-methylbenzene-1,3-diamine.
| Compound Name | 3-N-[3-[(2E,4E,7Z)-4-ethenyl-5-methylnona-2,4,7-trien-2-yl]imidazo[1,2-a]pyrazin-8-yl]-1-N-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 143464869 |
| Molecular Formula | C25H29N5 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 3-N-[3-[(2E,4E,7Z)-4-ethenyl-5-methylnona-2,4,7-trien-2-yl]imidazo[1,2-a]pyrazin-8-yl]-1-N-methylbenzene-1,3-diamine |
| SMILES | C=CC(/C=C(\C)c1cnc2c(Nc3cccc(NC)c3)nccn12)=C(/C)C/C=C\C |
| InChI | InChI=1S/C25H29N5/c1-6-8-10-18(3)20(7-2)15-19(4)23-17-28-25-24(27-13-14-30(23)25)29-22-12-9-11-21(16-22)26-5/h6-9,11-17,26H,2,10H2,1,3-5H3,(H,27,29)/b8-6-,19-15+,20-18+ |
| InChIKey | LBFSAPZIZMBRKI-DZPMSZGFSA-N |
| XLogP | 6.39 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|