C9H13NO — CID 143469017
1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one (PubChem CID 143469017) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one.
| Compound Name | 1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one |
|---|---|
| PubChem CID | 143469017 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one |
| SMILES | C/C=C\C1=C(C)N(C)C(=O)C1 |
| InChI | InChI=1S/C9H13NO/c1-4-5-8-6-9(11)10(3)7(8)2/h4-5H,6H2,1-3H3/b5-4- |
| InChIKey | MRJOATBXMZPYOH-PLNGDYQASA-N |
| XLogP | 1.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |