C10H13NO — CID 129180583
4,5-bis[(Z)-prop-1-enyl]-1,3-dihydropyrrol-2-one (PubChem CID 129180583) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 4,5-bis[(Z)-prop-1-enyl]-1,3-dihydropyrrol-2-one.
| Compound Name | 4,5-bis[(Z)-prop-1-enyl]-1,3-dihydropyrrol-2-one |
|---|---|
| PubChem CID | 129180583 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 4,5-bis[(Z)-prop-1-enyl]-1,3-dihydropyrrol-2-one |
| SMILES | C/C=C\C1=C(/C=C\C)NC(=O)C1 |
| InChI | InChI=1S/C10H13NO/c1-3-5-8-7-10(12)11-9(8)6-4-2/h3-6H,7H2,1-2H3,(H,11,12)/b5-3-,6-4- |
| InChIKey | UVPSOOMZSJZAPV-GLIMQPGKSA-N |
| XLogP | 1.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |