About 5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one
5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one (PubChem CID 143469092) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one.
Molecular Properties
| Compound Name | 5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one |
| PubChem CID | 143469092 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one |
| SMILES | C=Nc1c(C/C=C\C)oc(=O)n1C |
| InChI | InChI=1S/C9H12N2O2/c1-4-5-6-7-8(10-2)11(3)9(12)13-7/h4-5H,2,6H2,1,3H3/b5-4- |
| InChIKey | CVTCUZXSKOKORC-PLNGDYQASA-N |
| XLogP | 1.43 |
| TPSA | 47.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one?
The IUPAC name of 5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one (CID 143469092) is 5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one.
What is the SMILES notation for 5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one?
The canonical SMILES for 5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one is C=Nc1c(C/C=C\C)oc(=O)n1C.
What is the InChIKey of 5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one?
The InChIKey is CVTCUZXSKOKORC-PLNGDYQASA-N. The full InChI is InChI=1S/C9H12N2O2/c1-4-5-6-7-8(10-2)11(3)9(12)13-7/h4-5H,2,6H2,1,3H3/b5-4-.
What are the key properties of 5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one?
5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one has a molecular weight of 180.21 g/mol, XLogP of 1.43, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one is sourced from PubChem (CID 143469092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).