C9H12N2O2 — CID 143469092
5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one (PubChem CID 143469092) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one.
| Compound Name | 5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 143469092 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 5-[(Z)-but-2-enyl]-3-methyl-4-(methylideneamino)-1,3-oxazol-2-one |
| SMILES | C=Nc1c(C/C=C\C)oc(=O)n1C |
| InChI | InChI=1S/C9H12N2O2/c1-4-5-6-7-8(10-2)11(3)9(12)13-7/h4-5H,2,6H2,1,3H3/b5-4- |
| InChIKey | CVTCUZXSKOKORC-PLNGDYQASA-N |
| XLogP | 1.43 |
| TPSA | 47.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|