C14H20 — CID 173045793
3-but-2-enyl-1,2,4,5-tetramethylbenzene (PubChem CID 173045793) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 3-but-2-enyl-1,2,4,5-tetramethylbenzene.
| Compound Name | 3-but-2-enyl-1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 173045793 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 3-but-2-enyl-1,2,4,5-tetramethylbenzene |
| SMILES | CC=CCc1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C14H20/c1-6-7-8-14-12(4)10(2)9-11(3)13(14)5/h6-7,9H,8H2,1-5H3 |
| InChIKey | DAMOUVSGUWCPPN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|