C12H17NS — CID 83969576
2-(2,3,5,6-tetramethylphenyl)ethanethioamide (PubChem CID 83969576) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is 2-(2,3,5,6-tetramethylphenyl)ethanethioamide.
| Compound Name | 2-(2,3,5,6-tetramethylphenyl)ethanethioamide |
|---|---|
| PubChem CID | 83969576 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-(2,3,5,6-tetramethylphenyl)ethanethioamide |
| SMILES | Cc1cc(C)c(C)c(CC(N)=S)c1C |
| InChI | InChI=1S/C12H17NS/c1-7-5-8(2)10(4)11(9(7)3)6-12(13)14/h5H,6H2,1-4H3,(H2,13,14) |
| InChIKey | ZFJFHCKZNFBFPP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|